C20H16F4N2O4 — CID 86881191
N'-[4-fluoro-3-(trifluoromethyl)phenyl]-N-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]oxamide (PubChem CID 86881191) has the molecular formula C20H16F4N2O4 and a molecular weight of 424.35 g/mol. Its IUPAC name is N'-[4-fluoro-3-(trifluoromethyl)phenyl]-N-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]oxamide.
| Compound Name | N'-[4-fluoro-3-(trifluoromethyl)phenyl]-N-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 86881191 |
| Molecular Formula | C20H16F4N2O4 |
| Molecular Weight | 424.35 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | N'-[4-fluoro-3-(trifluoromethyl)phenyl]-N-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]oxamide |
| SMILES | C#CCOc1cc(CNC(=O)C(=O)Nc2ccc(F)c(C(F)(F)F)c2)ccc1OC |
| InChI | InChI=1S/C20H16F4N2O4/c1-3-8-30-17-9-12(4-7-16(17)29-2)11-25-18(27)19(28)26-13-5-6-15(21)14(10-13)20(22,23)24/h1,4-7,9-10H,8,11H2,2H3,(H,25,27)(H,26,28) |
| InChIKey | AGHDFPZAMQNVFA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|