C19H19BrN2O4 — CID 86882518
2-[3-(4-bromophenyl)-3-methyl-2,5-dioxopyrrolidin-1-yl]-N-[1-(furan-2-yl)ethyl]acetamide (PubChem CID 86882518) has the molecular formula C19H19BrN2O4 and a molecular weight of 419.28 g/mol. Its IUPAC name is 2-[3-(4-bromophenyl)-3-methyl-2,5-dioxopyrrolidin-1-yl]-N-[1-(furan-2-yl)ethyl]acetamide.
| Compound Name | 2-[3-(4-bromophenyl)-3-methyl-2,5-dioxopyrrolidin-1-yl]-N-[1-(furan-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 86882518 |
| Molecular Formula | C19H19BrN2O4 |
| Molecular Weight | 419.28 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | 2-[3-(4-bromophenyl)-3-methyl-2,5-dioxopyrrolidin-1-yl]-N-[1-(furan-2-yl)ethyl]acetamide |
| SMILES | CC(NC(=O)CN1C(=O)CC(C)(c2ccc(Br)cc2)C1=O)c1ccco1 |
| InChI | InChI=1S/C19H19BrN2O4/c1-12(15-4-3-9-26-15)21-16(23)11-22-17(24)10-19(2,18(22)25)13-5-7-14(20)8-6-13/h3-9,12H,10-11H2,1-2H3,(H,21,23) |
| InChIKey | OPQCEQZFYCPQAP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.28 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|