C19H23BrN2O3 — CID 86883261
3-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-methyl-1-(2-phenylethyl)urea (PubChem CID 86883261) has the molecular formula C19H23BrN2O3 and a molecular weight of 407.31 g/mol. Its IUPAC name is 3-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-methyl-1-(2-phenylethyl)urea.
| Compound Name | 3-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-methyl-1-(2-phenylethyl)urea |
|---|---|
| PubChem CID | 86883261 |
| Molecular Formula | C19H23BrN2O3 |
| Molecular Weight | 407.31 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 3-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-methyl-1-(2-phenylethyl)urea |
| SMILES | COc1cc(Br)c(CNC(=O)N(C)CCc2ccccc2)cc1OC |
| InChI | InChI=1S/C19H23BrN2O3/c1-22(10-9-14-7-5-4-6-8-14)19(23)21-13-15-11-17(24-2)18(25-3)12-16(15)20/h4-8,11-12H,9-10,13H2,1-3H3,(H,21,23) |
| InChIKey | ZOZBODSDWIWXOO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.31 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |