C23H26N4O3 — CID 86883578
5-cyclopropyl-N-[3-[(4-methoxyphenyl)methoxy]propyl]-1-phenyl-1,2,4-triazole-3-carboxamide (PubChem CID 86883578) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is 5-cyclopropyl-N-[3-[(4-methoxyphenyl)methoxy]propyl]-1-phenyl-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-cyclopropyl-N-[3-[(4-methoxyphenyl)methoxy]propyl]-1-phenyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 86883578 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 5-cyclopropyl-N-[3-[(4-methoxyphenyl)methoxy]propyl]-1-phenyl-1,2,4-triazole-3-carboxamide |
| SMILES | COc1ccc(COCCCNC(=O)c2nc(C3CC3)n(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C23H26N4O3/c1-29-20-12-8-17(9-13-20)16-30-15-5-14-24-23(28)21-25-22(18-10-11-18)27(26-21)19-6-3-2-4-7-19/h2-4,6-9,12-13,18H,5,10-11,14-16H2,1H3,(H,24,28) |
| InChIKey | URHDXGSYWZOGME-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|