C22H24N4O3S — CID 86881708
N-(3-benzylsulfonylpropyl)-5-cyclopropyl-1-phenyl-1,2,4-triazole-3-carboxamide (PubChem CID 86881708) has the molecular formula C22H24N4O3S and a molecular weight of 424.53 g/mol. Its IUPAC name is N-(3-benzylsulfonylpropyl)-5-cyclopropyl-1-phenyl-1,2,4-triazole-3-carboxamide.
| Compound Name | N-(3-benzylsulfonylpropyl)-5-cyclopropyl-1-phenyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 86881708 |
| Molecular Formula | C22H24N4O3S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | N-(3-benzylsulfonylpropyl)-5-cyclopropyl-1-phenyl-1,2,4-triazole-3-carboxamide |
| SMILES | O=C(NCCCS(=O)(=O)Cc1ccccc1)c1nc(C2CC2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H24N4O3S/c27-22(23-14-7-15-30(28,29)16-17-8-3-1-4-9-17)20-24-21(18-12-13-18)26(25-20)19-10-5-2-6-11-19/h1-6,8-11,18H,7,12-16H2,(H,23,27) |
| InChIKey | KSUNWPNABJSEJJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|