C23H21N5O3 — CID 86881343
5-cyclopropyl-N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-1-phenyl-1,2,4-triazole-3-carboxamide (PubChem CID 86881343) has the molecular formula C23H21N5O3 and a molecular weight of 415.45 g/mol. Its IUPAC name is 5-cyclopropyl-N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-1-phenyl-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-cyclopropyl-N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-1-phenyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 86881343 |
| Molecular Formula | C23H21N5O3 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 5-cyclopropyl-N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-1-phenyl-1,2,4-triazole-3-carboxamide |
| SMILES | O=C(Nc1ccc(CN2C(=O)CCC2=O)cc1)c1nc(C2CC2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C23H21N5O3/c29-19-12-13-20(30)27(19)14-15-6-10-17(11-7-15)24-23(31)21-25-22(16-8-9-16)28(26-21)18-4-2-1-3-5-18/h1-7,10-11,16H,8-9,12-14H2,(H,24,31) |
| InChIKey | YHDRUCWFGNEQQO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|