C24H25N7O — CID 86883841
5-cyclopropyl-N-[2-[[4-(dimethylamino)phenyl]methyl]pyrazol-3-yl]-1-phenyl-1,2,4-triazole-3-carboxamide (PubChem CID 86883841) has the molecular formula C24H25N7O and a molecular weight of 427.51 g/mol. Its IUPAC name is 5-cyclopropyl-N-[2-[[4-(dimethylamino)phenyl]methyl]pyrazol-3-yl]-1-phenyl-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-cyclopropyl-N-[2-[[4-(dimethylamino)phenyl]methyl]pyrazol-3-yl]-1-phenyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 86883841 |
| Molecular Formula | C24H25N7O |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 5-cyclopropyl-N-[2-[[4-(dimethylamino)phenyl]methyl]pyrazol-3-yl]-1-phenyl-1,2,4-triazole-3-carboxamide |
| SMILES | CN(C)c1ccc(Cn2nccc2NC(=O)c2nc(C3CC3)n(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C24H25N7O/c1-29(2)19-12-8-17(9-13-19)16-30-21(14-15-25-30)26-24(32)22-27-23(18-10-11-18)31(28-22)20-6-4-3-5-7-20/h3-9,12-15,18H,10-11,16H2,1-2H3,(H,26,32) |
| InChIKey | WUKBFVHTFHDEAE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 80.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|