C25H26N4O3 — CID 86934045
[4-(cyclohexanecarbonylamino)phenyl] 5-cyclopropyl-1-phenyl-1,2,4-triazole-3-carboxylate (PubChem CID 86934045) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is [4-(cyclohexanecarbonylamino)phenyl] 5-cyclopropyl-1-phenyl-1,2,4-triazole-3-carboxylate.
| Compound Name | [4-(cyclohexanecarbonylamino)phenyl] 5-cyclopropyl-1-phenyl-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 86934045 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | [4-(cyclohexanecarbonylamino)phenyl] 5-cyclopropyl-1-phenyl-1,2,4-triazole-3-carboxylate |
| SMILES | O=C(Oc1ccc(NC(=O)C2CCCCC2)cc1)c1nc(C2CC2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C25H26N4O3/c30-24(18-7-3-1-4-8-18)26-19-13-15-21(16-14-19)32-25(31)22-27-23(17-11-12-17)29(28-22)20-9-5-2-6-10-20/h2,5-6,9-10,13-18H,1,3-4,7-8,11-12H2,(H,26,30) |
| InChIKey | VZBCAXKYMSDRFF-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|