C25H27N3O4 — CID 86934059
[4-(cyclohexanecarbonylamino)phenyl] 4-(5-phenyl-1,3,4-oxadiazol-2-yl)butanoate (PubChem CID 86934059) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is [4-(cyclohexanecarbonylamino)phenyl] 4-(5-phenyl-1,3,4-oxadiazol-2-yl)butanoate.
| Compound Name | [4-(cyclohexanecarbonylamino)phenyl] 4-(5-phenyl-1,3,4-oxadiazol-2-yl)butanoate |
|---|---|
| PubChem CID | 86934059 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | [4-(cyclohexanecarbonylamino)phenyl] 4-(5-phenyl-1,3,4-oxadiazol-2-yl)butanoate |
| SMILES | O=C(CCCc1nnc(-c2ccccc2)o1)Oc1ccc(NC(=O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C25H27N3O4/c29-23(13-7-12-22-27-28-25(32-22)19-10-5-2-6-11-19)31-21-16-14-20(15-17-21)26-24(30)18-8-3-1-4-9-18/h2,5-6,10-11,14-18H,1,3-4,7-9,12-13H2,(H,26,30) |
| InChIKey | KYQHDQDGGFAHJO-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|