C24H27N5O2 — CID 86883847
N-[2-[[4-(dimethylamino)phenyl]methyl]pyrazol-3-yl]-2-[[(E)-3-phenylprop-2-enoyl]amino]propanamide (PubChem CID 86883847) has the molecular formula C24H27N5O2 and a molecular weight of 417.51 g/mol. Its IUPAC name is N-[2-[[4-(dimethylamino)phenyl]methyl]pyrazol-3-yl]-2-[[(E)-3-phenylprop-2-enoyl]amino]propanamide.
| Compound Name | N-[2-[[4-(dimethylamino)phenyl]methyl]pyrazol-3-yl]-2-[[(E)-3-phenylprop-2-enoyl]amino]propanamide |
|---|---|
| PubChem CID | 86883847 |
| Molecular Formula | C24H27N5O2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | N-[2-[[4-(dimethylamino)phenyl]methyl]pyrazol-3-yl]-2-[[(E)-3-phenylprop-2-enoyl]amino]propanamide |
| SMILES | CC(NC(=O)/C=C/c1ccccc1)C(=O)Nc1ccnn1Cc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C24H27N5O2/c1-18(26-23(30)14-11-19-7-5-4-6-8-19)24(31)27-22-15-16-25-29(22)17-20-9-12-21(13-10-20)28(2)3/h4-16,18H,17H2,1-3H3,(H,26,30)(H,27,31)/b14-11+ |
| InChIKey | WQOMTTWKWGMNLP-SDNWHVSQSA-N |
| XLogP | 3.15 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|