C22H28N6O2S — CID 86884535
1-[1-(5-cyano-2-pyridinyl)piperidin-4-yl]-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)urea (PubChem CID 86884535) has the molecular formula C22H28N6O2S and a molecular weight of 440.57 g/mol. Its IUPAC name is 1-[1-(5-cyano-2-pyridinyl)piperidin-4-yl]-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)urea.
| Compound Name | 1-[1-(5-cyano-2-pyridinyl)piperidin-4-yl]-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)urea |
|---|---|
| PubChem CID | 86884535 |
| Molecular Formula | C22H28N6O2S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 1-[1-(5-cyano-2-pyridinyl)piperidin-4-yl]-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)urea |
| SMILES | N#Cc1ccc(N2CCC(NC(=O)NCC(c3cccs3)N3CCOCC3)CC2)nc1 |
| InChI | InChI=1S/C22H28N6O2S/c23-14-17-3-4-21(24-15-17)28-7-5-18(6-8-28)26-22(29)25-16-19(20-2-1-13-31-20)27-9-11-30-12-10-27/h1-4,13,15,18-19H,5-12,16H2,(H2,25,26,29) |
| InChIKey | UAEQWTYFUHXHCH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 93.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |