About 2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethyl 2-(2-chlorophenyl)-1,3-thiazole-4-carboxylate
2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethyl 2-(2-chlorophenyl)-1,3-thiazole-4-carboxylate (PubChem CID 86884798) has the molecular formula C16H11ClF3N3O2S
and a molecular weight of 401.80 g/mol. Its IUPAC name is 2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethyl 2-(2-chlorophenyl)-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | 2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethyl 2-(2-chlorophenyl)-1,3-thiazole-4-carboxylate |
| PubChem CID | 86884798 |
| Molecular Formula | C16H11ClF3N3O2S |
| Molecular Weight | 401.80 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | 2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethyl 2-(2-chlorophenyl)-1,3-thiazole-4-carboxylate |
| SMILES | O=C(OCCc1cn[nH]c1C(F)(F)F)c1csc(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C16H11ClF3N3O2S/c17-11-4-2-1-3-10(11)14-22-12(8-26-14)15(24)25-6-5-9-7-21-23-13(9)16(18,19)20/h1-4,7-8H,5-6H2,(H,21,23) |
| InChIKey | ZCLZYXJNCOLHTG-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.80 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethyl 2-(2-chlorophenyl)-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethyl 2-(2-chlorophenyl)-1,3-thiazole-4-carboxylate?
The IUPAC name of 2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethyl 2-(2-chlorophenyl)-1,3-thiazole-4-carboxylate (CID 86884798) is 2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethyl 2-(2-chlorophenyl)-1,3-thiazole-4-carboxylate.
What is the SMILES notation for 2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethyl 2-(2-chlorophenyl)-1,3-thiazole-4-carboxylate?
The canonical SMILES for 2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethyl 2-(2-chlorophenyl)-1,3-thiazole-4-carboxylate is O=C(OCCc1cn[nH]c1C(F)(F)F)c1csc(-c2ccccc2Cl)n1.
What is the InChIKey of 2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethyl 2-(2-chlorophenyl)-1,3-thiazole-4-carboxylate?
The InChIKey is ZCLZYXJNCOLHTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11ClF3N3O2S/c17-11-4-2-1-3-10(11)14-22-12(8-26-14)15(24)25-6-5-9-7-21-23-13(9)16(18,19)20/h1-4,7-8H,5-6H2,(H,21,23).
What are the key properties of 2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethyl 2-(2-chlorophenyl)-1,3-thiazole-4-carboxylate?
2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethyl 2-(2-chlorophenyl)-1,3-thiazole-4-carboxylate has a molecular weight of 401.80 g/mol, XLogP of 4.60, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethyl 2-(2-chlorophenyl)-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 86884798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).