About [1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl 3-methoxy-4-phenylmethoxybenzoate
[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl 3-methoxy-4-phenylmethoxybenzoate (PubChem CID 86885631) has the molecular formula C21H19F3N2O4
and a molecular weight of 420.39 g/mol. Its IUPAC name is [1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl 3-methoxy-4-phenylmethoxybenzoate.
Molecular Properties
| Compound Name | [1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl 3-methoxy-4-phenylmethoxybenzoate |
| PubChem CID | 86885631 |
| Molecular Formula | C21H19F3N2O4 |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | [1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl 3-methoxy-4-phenylmethoxybenzoate |
| SMILES | COc1cc(C(=O)OCc2nccn2CC(F)(F)F)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C21H19F3N2O4/c1-28-18-11-16(7-8-17(18)29-12-15-5-3-2-4-6-15)20(27)30-13-19-25-9-10-26(19)14-21(22,23)24/h2-11H,12-14H2,1H3 |
| InChIKey | QALWCRQNJNTLTA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl 3-methoxy-4-phenylmethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl 3-methoxy-4-phenylmethoxybenzoate?
The IUPAC name of [1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl 3-methoxy-4-phenylmethoxybenzoate (CID 86885631) is [1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl 3-methoxy-4-phenylmethoxybenzoate.
What is the SMILES notation for [1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl 3-methoxy-4-phenylmethoxybenzoate?
The canonical SMILES for [1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl 3-methoxy-4-phenylmethoxybenzoate is COc1cc(C(=O)OCc2nccn2CC(F)(F)F)ccc1OCc1ccccc1.
What is the InChIKey of [1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl 3-methoxy-4-phenylmethoxybenzoate?
The InChIKey is QALWCRQNJNTLTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19F3N2O4/c1-28-18-11-16(7-8-17(18)29-12-15-5-3-2-4-6-15)20(27)30-13-19-25-9-10-26(19)14-21(22,23)24/h2-11H,12-14H2,1H3.
What are the key properties of [1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl 3-methoxy-4-phenylmethoxybenzoate?
[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl 3-methoxy-4-phenylmethoxybenzoate has a molecular weight of 420.39 g/mol, XLogP of 4.39, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl 3-methoxy-4-phenylmethoxybenzoate is sourced from PubChem (CID 86885631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).