C20H30F3N3O3S — CID 86889050
N-[[4-(dimethylamino)phenyl]methyl]-1-propylsulfonyl-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide (PubChem CID 86889050) has the molecular formula C20H30F3N3O3S and a molecular weight of 449.54 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-1-propylsulfonyl-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-1-propylsulfonyl-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 86889050 |
| Molecular Formula | C20H30F3N3O3S |
| Molecular Weight | 449.54 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-1-propylsulfonyl-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide |
| SMILES | CCCS(=O)(=O)N1CCCC(C(=O)N(Cc2ccc(N(C)C)cc2)CC(F)(F)F)C1 |
| InChI | InChI=1S/C20H30F3N3O3S/c1-4-12-30(28,29)26-11-5-6-17(14-26)19(27)25(15-20(21,22)23)13-16-7-9-18(10-8-16)24(2)3/h7-10,17H,4-6,11-15H2,1-3H3 |
| InChIKey | ZFXLHBQJBHVUJS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.54 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|