C23H25ClFN5O — CID 86896534
(E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[[4-(4-ethylpiperazin-1-yl)-3-fluorophenyl]methyl]prop-2-enamide (PubChem CID 86896534) has the molecular formula C23H25ClFN5O and a molecular weight of 441.94 g/mol. Its IUPAC name is (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[[4-(4-ethylpiperazin-1-yl)-3-fluorophenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[[4-(4-ethylpiperazin-1-yl)-3-fluorophenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 86896534 |
| Molecular Formula | C23H25ClFN5O |
| Molecular Weight | 441.94 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[[4-(4-ethylpiperazin-1-yl)-3-fluorophenyl]methyl]prop-2-enamide |
| SMILES | CCN1CCN(c2ccc(CNC(=O)/C=C/c3c(Cl)nc4ccccn34)cc2F)CC1 |
| InChI | InChI=1S/C23H25ClFN5O/c1-2-28-11-13-29(14-12-28)19-7-6-17(15-18(19)25)16-26-22(31)9-8-20-23(24)27-21-5-3-4-10-30(20)21/h3-10,15H,2,11-14,16H2,1H3,(H,26,31)/b9-8+ |
| InChIKey | BEMZYSUCNFMIFU-CMDGGOBGSA-N |
| XLogP | 3.60 |
| TPSA | 52.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.94 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|