C19H16F2N2O3 — CID 86897632
2-[3-(difluoromethoxy)phenyl]-N-(2-methoxyquinolin-6-yl)acetamide (PubChem CID 86897632) has the molecular formula C19H16F2N2O3 and a molecular weight of 358.34 g/mol. Its IUPAC name is 2-[3-(difluoromethoxy)phenyl]-N-(2-methoxyquinolin-6-yl)acetamide.
| Compound Name | 2-[3-(difluoromethoxy)phenyl]-N-(2-methoxyquinolin-6-yl)acetamide |
|---|---|
| PubChem CID | 86897632 |
| Molecular Formula | C19H16F2N2O3 |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 2-[3-(difluoromethoxy)phenyl]-N-(2-methoxyquinolin-6-yl)acetamide |
| SMILES | COc1ccc2cc(NC(=O)Cc3cccc(OC(F)F)c3)ccc2n1 |
| InChI | InChI=1S/C19H16F2N2O3/c1-25-18-8-5-13-11-14(6-7-16(13)23-18)22-17(24)10-12-3-2-4-15(9-12)26-19(20)21/h2-9,11,19H,10H2,1H3,(H,22,24) |
| InChIKey | CAEYMQAIEQGSAZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |