C22H32N2O3 — CID 86898749
tert-butyl N-[1-[(E)-3-(2,4-dimethylphenyl)prop-2-enoyl]piperidin-4-yl]-N-methylcarbamate (PubChem CID 86898749) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is tert-butyl N-[1-[(E)-3-(2,4-dimethylphenyl)prop-2-enoyl]piperidin-4-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[1-[(E)-3-(2,4-dimethylphenyl)prop-2-enoyl]piperidin-4-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 86898749 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | tert-butyl N-[1-[(E)-3-(2,4-dimethylphenyl)prop-2-enoyl]piperidin-4-yl]-N-methylcarbamate |
| SMILES | Cc1ccc(/C=C/C(=O)N2CCC(N(C)C(=O)OC(C)(C)C)CC2)c(C)c1 |
| InChI | InChI=1S/C22H32N2O3/c1-16-7-8-18(17(2)15-16)9-10-20(25)24-13-11-19(12-14-24)23(6)21(26)27-22(3,4)5/h7-10,15,19H,11-14H2,1-6H3/b10-9+ |
| InChIKey | WOCQGGRLXDKVRK-MDZDMXLPSA-N |
| XLogP | 4.17 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|