C25H28FN3O3 — CID 86899076
4-[[4-(4-fluorophenyl)oxan-4-yl]carbamoylamino]-N,N-bis(prop-2-enyl)benzamide (PubChem CID 86899076) has the molecular formula C25H28FN3O3 and a molecular weight of 437.52 g/mol. Its IUPAC name is 4-[[4-(4-fluorophenyl)oxan-4-yl]carbamoylamino]-N,N-bis(prop-2-enyl)benzamide.
| Compound Name | 4-[[4-(4-fluorophenyl)oxan-4-yl]carbamoylamino]-N,N-bis(prop-2-enyl)benzamide |
|---|---|
| PubChem CID | 86899076 |
| Molecular Formula | C25H28FN3O3 |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 4-[[4-(4-fluorophenyl)oxan-4-yl]carbamoylamino]-N,N-bis(prop-2-enyl)benzamide |
| SMILES | C=CCN(CC=C)C(=O)c1ccc(NC(=O)NC2(c3ccc(F)cc3)CCOCC2)cc1 |
| InChI | InChI=1S/C25H28FN3O3/c1-3-15-29(16-4-2)23(30)19-5-11-22(12-6-19)27-24(31)28-25(13-17-32-18-14-25)20-7-9-21(26)10-8-20/h3-12H,1-2,13-18H2,(H2,27,28,31) |
| InChIKey | CUIZDPWMDHPJPB-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|