C25H24N2O3S — CID 86900057
N-[2-(2-cyanopropylsulfanyl)phenyl]-3-methoxy-4-phenylmethoxybenzamide (PubChem CID 86900057) has the molecular formula C25H24N2O3S and a molecular weight of 432.55 g/mol. Its IUPAC name is N-[2-(2-cyanopropylsulfanyl)phenyl]-3-methoxy-4-phenylmethoxybenzamide.
| Compound Name | N-[2-(2-cyanopropylsulfanyl)phenyl]-3-methoxy-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 86900057 |
| Molecular Formula | C25H24N2O3S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | N-[2-(2-cyanopropylsulfanyl)phenyl]-3-methoxy-4-phenylmethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccccc2SCC(C)C#N)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C25H24N2O3S/c1-18(15-26)17-31-24-11-7-6-10-21(24)27-25(28)20-12-13-22(23(14-20)29-2)30-16-19-8-4-3-5-9-19/h3-14,18H,16-17H2,1-2H3,(H,27,28) |
| InChIKey | OGBNNZPIHQGXBR-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |