C17H16FNO3S — CID 86900068
3-fluoro-N,4-dimethyl-N-(4-prop-2-ynoxyphenyl)benzenesulfonamide (PubChem CID 86900068) has the molecular formula C17H16FNO3S and a molecular weight of 333.38 g/mol. Its IUPAC name is 3-fluoro-N,4-dimethyl-N-(4-prop-2-ynoxyphenyl)benzenesulfonamide.
| Compound Name | 3-fluoro-N,4-dimethyl-N-(4-prop-2-ynoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 86900068 |
| Molecular Formula | C17H16FNO3S |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 3-fluoro-N,4-dimethyl-N-(4-prop-2-ynoxyphenyl)benzenesulfonamide |
| SMILES | C#CCOc1ccc(N(C)S(=O)(=O)c2ccc(C)c(F)c2)cc1 |
| InChI | InChI=1S/C17H16FNO3S/c1-4-11-22-15-8-6-14(7-9-15)19(3)23(20,21)16-10-5-13(2)17(18)12-16/h1,5-10,12H,11H2,2-3H3 |
| InChIKey | NDHRGDFIIBVESQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|