C24H36N4O3 — CID 86900794
N-[1-[2-(diethylamino)-2-oxoethyl]indol-5-yl]-4-propoxyazepane-1-carboxamide (PubChem CID 86900794) has the molecular formula C24H36N4O3 and a molecular weight of 428.58 g/mol. Its IUPAC name is N-[1-[2-(diethylamino)-2-oxoethyl]indol-5-yl]-4-propoxyazepane-1-carboxamide.
| Compound Name | N-[1-[2-(diethylamino)-2-oxoethyl]indol-5-yl]-4-propoxyazepane-1-carboxamide |
|---|---|
| PubChem CID | 86900794 |
| Molecular Formula | C24H36N4O3 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | N-[1-[2-(diethylamino)-2-oxoethyl]indol-5-yl]-4-propoxyazepane-1-carboxamide |
| SMILES | CCCOC1CCCN(C(=O)Nc2ccc3c(ccn3CC(=O)N(CC)CC)c2)CC1 |
| InChI | InChI=1S/C24H36N4O3/c1-4-16-31-21-8-7-13-27(15-12-21)24(30)25-20-9-10-22-19(17-20)11-14-28(22)18-23(29)26(5-2)6-3/h9-11,14,17,21H,4-8,12-13,15-16,18H2,1-3H3,(H,25,30) |
| InChIKey | LMULFGAHFJXYIL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |