C19H22BrNO3S — CID 86904362
N-[2-(4-bromophenyl)sulfanylpropyl]-2-(3,4-dimethoxyphenyl)acetamide (PubChem CID 86904362) has the molecular formula C19H22BrNO3S and a molecular weight of 424.36 g/mol. Its IUPAC name is N-[2-(4-bromophenyl)sulfanylpropyl]-2-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | N-[2-(4-bromophenyl)sulfanylpropyl]-2-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 86904362 |
| Molecular Formula | C19H22BrNO3S |
| Molecular Weight | 424.36 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | N-[2-(4-bromophenyl)sulfanylpropyl]-2-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)NCC(C)Sc2ccc(Br)cc2)cc1OC |
| InChI | InChI=1S/C19H22BrNO3S/c1-13(25-16-7-5-15(20)6-8-16)12-21-19(22)11-14-4-9-17(23-2)18(10-14)24-3/h4-10,13H,11-12H2,1-3H3,(H,21,22) |
| InChIKey | MNTILBFWEZHNSN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.36 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |