C15H16ClN3OS2 — CID 86914585
3-[(3-chloro-1-benzothiophen-2-yl)methylsulfanyl]-4-(3-methoxypropyl)-1,2,4-triazole (PubChem CID 86914585) has the molecular formula C15H16ClN3OS2 and a molecular weight of 353.90 g/mol. Its IUPAC name is 3-[(3-chloro-1-benzothiophen-2-yl)methylsulfanyl]-4-(3-methoxypropyl)-1,2,4-triazole.
| Compound Name | 3-[(3-chloro-1-benzothiophen-2-yl)methylsulfanyl]-4-(3-methoxypropyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 86914585 |
| Molecular Formula | C15H16ClN3OS2 |
| Molecular Weight | 353.90 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | 3-[(3-chloro-1-benzothiophen-2-yl)methylsulfanyl]-4-(3-methoxypropyl)-1,2,4-triazole |
| SMILES | COCCCn1cnnc1SCc1sc2ccccc2c1Cl |
| InChI | InChI=1S/C15H16ClN3OS2/c1-20-8-4-7-19-10-17-18-15(19)21-9-13-14(16)11-5-2-3-6-12(11)22-13/h2-3,5-6,10H,4,7-9H2,1H3 |
| InChIKey | TVLSFIMCMWWPLV-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.90 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|