C15H18ClN5OS — CID 87018067
5-chloro-2-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-1-methylbenzimidazole (PubChem CID 87018067) has the molecular formula C15H18ClN5OS and a molecular weight of 351.86 g/mol. Its IUPAC name is 5-chloro-2-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-1-methylbenzimidazole.
| Compound Name | 5-chloro-2-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-1-methylbenzimidazole |
|---|---|
| PubChem CID | 87018067 |
| Molecular Formula | C15H18ClN5OS |
| Molecular Weight | 351.86 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 5-chloro-2-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-1-methylbenzimidazole |
| SMILES | COCCCn1cnnc1SCc1nc2cc(Cl)ccc2n1C |
| InChI | InChI=1S/C15H18ClN5OS/c1-20-13-5-4-11(16)8-12(13)18-14(20)9-23-15-19-17-10-21(15)6-3-7-22-2/h4-5,8,10H,3,6-7,9H2,1-2H3 |
| InChIKey | PBRHUGPBOLWDLP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 57.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.86 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|