C10H16Cl2N2O2 — CID 86915229
N-[2-(tert-butylamino)-2-oxoethyl]-2,2-dichlorocyclopropane-1-carboxamide (PubChem CID 86915229) has the molecular formula C10H16Cl2N2O2 and a molecular weight of 267.16 g/mol. Its IUPAC name is N-[2-(tert-butylamino)-2-oxoethyl]-2,2-dichlorocyclopropane-1-carboxamide.
| Compound Name | N-[2-(tert-butylamino)-2-oxoethyl]-2,2-dichlorocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 86915229 |
| Molecular Formula | C10H16Cl2N2O2 |
| Molecular Weight | 267.16 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | N-[2-(tert-butylamino)-2-oxoethyl]-2,2-dichlorocyclopropane-1-carboxamide |
| SMILES | CC(C)(C)NC(=O)CNC(=O)C1CC1(Cl)Cl |
| InChI | InChI=1S/C10H16Cl2N2O2/c1-9(2,3)14-7(15)5-13-8(16)6-4-10(6,11)12/h6H,4-5H2,1-3H3,(H,13,16)(H,14,15) |
| InChIKey | WBULIPBRCDOUJJ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.16 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|