C9H13Cl2NO — CID 86921284
2,2-dichloro-N-(cyclopropylmethyl)-1-methylcyclopropane-1-carboxamide (PubChem CID 86921284) has the molecular formula C9H13Cl2NO and a molecular weight of 222.11 g/mol. Its IUPAC name is 2,2-dichloro-N-(cyclopropylmethyl)-1-methylcyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-(cyclopropylmethyl)-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 86921284 |
| Molecular Formula | C9H13Cl2NO |
| Molecular Weight | 222.11 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | 2,2-dichloro-N-(cyclopropylmethyl)-1-methylcyclopropane-1-carboxamide |
| SMILES | CC1(C(=O)NCC2CC2)CC1(Cl)Cl |
| InChI | InChI=1S/C9H13Cl2NO/c1-8(5-9(8,10)11)7(13)12-4-6-2-3-6/h6H,2-5H2,1H3,(H,12,13) |
| InChIKey | NKBHMUREYIXFIP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.11 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|