C20H20N4O4 — CID 86925104
N-[4-[[(6-methoxy-3-pyridinyl)methylcarbamoylamino]methyl]phenyl]furan-2-carboxamide (PubChem CID 86925104) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is N-[4-[[(6-methoxy-3-pyridinyl)methylcarbamoylamino]methyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[[(6-methoxy-3-pyridinyl)methylcarbamoylamino]methyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 86925104 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | N-[4-[[(6-methoxy-3-pyridinyl)methylcarbamoylamino]methyl]phenyl]furan-2-carboxamide |
| SMILES | COc1ccc(CNC(=O)NCc2ccc(NC(=O)c3ccco3)cc2)cn1 |
| InChI | InChI=1S/C20H20N4O4/c1-27-18-9-6-15(12-21-18)13-23-20(26)22-11-14-4-7-16(8-5-14)24-19(25)17-3-2-10-28-17/h2-10,12H,11,13H2,1H3,(H,24,25)(H2,22,23,26) |
| InChIKey | YWFZXROKPSDTRI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |