C19H21BrN2O4 — CID 86932307
ethyl N-[3-[2-[(2-bromophenyl)methyl-methylamino]-2-oxoethoxy]phenyl]carbamate (PubChem CID 86932307) has the molecular formula C19H21BrN2O4 and a molecular weight of 421.29 g/mol. Its IUPAC name is ethyl N-[3-[2-[(2-bromophenyl)methyl-methylamino]-2-oxoethoxy]phenyl]carbamate.
| Compound Name | ethyl N-[3-[2-[(2-bromophenyl)methyl-methylamino]-2-oxoethoxy]phenyl]carbamate |
|---|---|
| PubChem CID | 86932307 |
| Molecular Formula | C19H21BrN2O4 |
| Molecular Weight | 421.29 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | ethyl N-[3-[2-[(2-bromophenyl)methyl-methylamino]-2-oxoethoxy]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1cccc(OCC(=O)N(C)Cc2ccccc2Br)c1 |
| InChI | InChI=1S/C19H21BrN2O4/c1-3-25-19(24)21-15-8-6-9-16(11-15)26-13-18(23)22(2)12-14-7-4-5-10-17(14)20/h4-11H,3,12-13H2,1-2H3,(H,21,24) |
| InChIKey | SPDSYRGUHWXKHQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.29 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |