C15H21NO4 — CID 86937874
2-[ethoxycarbonyl(methyl)amino]ethyl 2,5-dimethylbenzoate (PubChem CID 86937874) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-[ethoxycarbonyl(methyl)amino]ethyl 2,5-dimethylbenzoate.
| Compound Name | 2-[ethoxycarbonyl(methyl)amino]ethyl 2,5-dimethylbenzoate |
|---|---|
| PubChem CID | 86937874 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 2-[ethoxycarbonyl(methyl)amino]ethyl 2,5-dimethylbenzoate |
| SMILES | CCOC(=O)N(C)CCOC(=O)c1cc(C)ccc1C |
| InChI | InChI=1S/C15H21NO4/c1-5-19-15(18)16(4)8-9-20-14(17)13-10-11(2)6-7-12(13)3/h6-7,10H,5,8-9H2,1-4H3 |
| InChIKey | ZCLCOJCJUAQHKU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |