C22H33N3O2S — CID 86938918
4-(3-ethylsulfanylazepane-1-carbonyl)-N-(3-methylphenyl)piperidine-1-carboxamide (PubChem CID 86938918) has the molecular formula C22H33N3O2S and a molecular weight of 403.59 g/mol. Its IUPAC name is 4-(3-ethylsulfanylazepane-1-carbonyl)-N-(3-methylphenyl)piperidine-1-carboxamide.
| Compound Name | 4-(3-ethylsulfanylazepane-1-carbonyl)-N-(3-methylphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 86938918 |
| Molecular Formula | C22H33N3O2S |
| Molecular Weight | 403.59 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 4-(3-ethylsulfanylazepane-1-carbonyl)-N-(3-methylphenyl)piperidine-1-carboxamide |
| SMILES | CCSC1CCCCN(C(=O)C2CCN(C(=O)Nc3cccc(C)c3)CC2)C1 |
| InChI | InChI=1S/C22H33N3O2S/c1-3-28-20-9-4-5-12-25(16-20)21(26)18-10-13-24(14-11-18)22(27)23-19-8-6-7-17(2)15-19/h6-8,15,18,20H,3-5,9-14,16H2,1-2H3,(H,23,27) |
| InChIKey | JJNJHHKKFXKFFI-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.59 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |