C19H17F2NO2 — CID 86946401
N-[4-(3,4-difluorophenyl)butan-2-yl]-1-benzofuran-3-carboxamide (PubChem CID 86946401) has the molecular formula C19H17F2NO2 and a molecular weight of 329.35 g/mol. Its IUPAC name is N-[4-(3,4-difluorophenyl)butan-2-yl]-1-benzofuran-3-carboxamide.
| Compound Name | N-[4-(3,4-difluorophenyl)butan-2-yl]-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 86946401 |
| Molecular Formula | C19H17F2NO2 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | N-[4-(3,4-difluorophenyl)butan-2-yl]-1-benzofuran-3-carboxamide |
| SMILES | CC(CCc1ccc(F)c(F)c1)NC(=O)c1coc2ccccc12 |
| InChI | InChI=1S/C19H17F2NO2/c1-12(6-7-13-8-9-16(20)17(21)10-13)22-19(23)15-11-24-18-5-3-2-4-14(15)18/h2-5,8-12H,6-7H2,1H3,(H,22,23) |
| InChIKey | JPIACKIHWFYZEM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |