C19H25ClN6O2 — CID 86947532
1-[2-chloro-6-(dimethylamino)pyridine-4-carbonyl]-N-(1-ethylpyrazol-4-yl)piperidine-4-carboxamide (PubChem CID 86947532) has the molecular formula C19H25ClN6O2 and a molecular weight of 404.90 g/mol. Its IUPAC name is 1-[2-chloro-6-(dimethylamino)pyridine-4-carbonyl]-N-(1-ethylpyrazol-4-yl)piperidine-4-carboxamide.
| Compound Name | 1-[2-chloro-6-(dimethylamino)pyridine-4-carbonyl]-N-(1-ethylpyrazol-4-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 86947532 |
| Molecular Formula | C19H25ClN6O2 |
| Molecular Weight | 404.90 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 1-[2-chloro-6-(dimethylamino)pyridine-4-carbonyl]-N-(1-ethylpyrazol-4-yl)piperidine-4-carboxamide |
| SMILES | CCn1cc(NC(=O)C2CCN(C(=O)c3cc(Cl)nc(N(C)C)c3)CC2)cn1 |
| InChI | InChI=1S/C19H25ClN6O2/c1-4-26-12-15(11-21-26)22-18(27)13-5-7-25(8-6-13)19(28)14-9-16(20)23-17(10-14)24(2)3/h9-13H,4-8H2,1-3H3,(H,22,27) |
| InChIKey | WYLNPQHQPMMKBO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.90 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|