C21H23ClN4O3 — CID 86973530
1-(6-chloro-2H-chromene-3-carbonyl)-N-(1-ethylpyrazol-4-yl)piperidine-4-carboxamide (PubChem CID 86973530) has the molecular formula C21H23ClN4O3 and a molecular weight of 414.89 g/mol. Its IUPAC name is 1-(6-chloro-2H-chromene-3-carbonyl)-N-(1-ethylpyrazol-4-yl)piperidine-4-carboxamide.
| Compound Name | 1-(6-chloro-2H-chromene-3-carbonyl)-N-(1-ethylpyrazol-4-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 86973530 |
| Molecular Formula | C21H23ClN4O3 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 1-(6-chloro-2H-chromene-3-carbonyl)-N-(1-ethylpyrazol-4-yl)piperidine-4-carboxamide |
| SMILES | CCn1cc(NC(=O)C2CCN(C(=O)C3=Cc4cc(Cl)ccc4OC3)CC2)cn1 |
| InChI | InChI=1S/C21H23ClN4O3/c1-2-26-12-18(11-23-26)24-20(27)14-5-7-25(8-6-14)21(28)16-9-15-10-17(22)3-4-19(15)29-13-16/h3-4,9-12,14H,2,5-8,13H2,1H3,(H,24,27) |
| InChIKey | RHBZBWJLQYWZAJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |