C18H24N2O3 — CID 86948250
N-[3-(2,6-dimethylphenoxy)propyl]-3-propan-2-yl-1,2-oxazole-5-carboxamide (PubChem CID 86948250) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is N-[3-(2,6-dimethylphenoxy)propyl]-3-propan-2-yl-1,2-oxazole-5-carboxamide.
| Compound Name | N-[3-(2,6-dimethylphenoxy)propyl]-3-propan-2-yl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 86948250 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | N-[3-(2,6-dimethylphenoxy)propyl]-3-propan-2-yl-1,2-oxazole-5-carboxamide |
| SMILES | Cc1cccc(C)c1OCCCNC(=O)c1cc(C(C)C)no1 |
| InChI | InChI=1S/C18H24N2O3/c1-12(2)15-11-16(23-20-15)18(21)19-9-6-10-22-17-13(3)7-5-8-14(17)4/h5,7-8,11-12H,6,9-10H2,1-4H3,(H,19,21) |
| InChIKey | SDJWPFYVHFUYBQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|