C16H17F2N3O3 — CID 84584001
N-[2-[(2,4-difluorobenzoyl)amino]ethyl]-3-propan-2-yl-1,2-oxazole-5-carboxamide (PubChem CID 84584001) has the molecular formula C16H17F2N3O3 and a molecular weight of 337.33 g/mol. Its IUPAC name is N-[2-[(2,4-difluorobenzoyl)amino]ethyl]-3-propan-2-yl-1,2-oxazole-5-carboxamide.
| Compound Name | N-[2-[(2,4-difluorobenzoyl)amino]ethyl]-3-propan-2-yl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 84584001 |
| Molecular Formula | C16H17F2N3O3 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | N-[2-[(2,4-difluorobenzoyl)amino]ethyl]-3-propan-2-yl-1,2-oxazole-5-carboxamide |
| SMILES | CC(C)c1cc(C(=O)NCCNC(=O)c2ccc(F)cc2F)on1 |
| InChI | InChI=1S/C16H17F2N3O3/c1-9(2)13-8-14(24-21-13)16(23)20-6-5-19-15(22)11-4-3-10(17)7-12(11)18/h3-4,7-9H,5-6H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | VYNFAAILRQJVLC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|