C23H24N4O4 — CID 86949953
N-[[4-(3,5-dimethoxyphenoxy)phenyl]methyl]-2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethanamine (PubChem CID 86949953) has the molecular formula C23H24N4O4 and a molecular weight of 420.47 g/mol. Its IUPAC name is N-[[4-(3,5-dimethoxyphenoxy)phenyl]methyl]-2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethanamine.
| Compound Name | N-[[4-(3,5-dimethoxyphenoxy)phenyl]methyl]-2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 86949953 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | N-[[4-(3,5-dimethoxyphenoxy)phenyl]methyl]-2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethanamine |
| SMILES | COc1cc(OC)cc(Oc2ccc(CNCCc3nc(-c4ccco4)n[nH]3)cc2)c1 |
| InChI | InChI=1S/C23H24N4O4/c1-28-18-12-19(29-2)14-20(13-18)31-17-7-5-16(6-8-17)15-24-10-9-22-25-23(27-26-22)21-4-3-11-30-21/h3-8,11-14,24H,9-10,15H2,1-2H3,(H,25,26,27) |
| InChIKey | SQPSSIIHWRNCGT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 94.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|