C21H27N3O3S — CID 86954439
(E)-3-[4-(dimethylsulfamoyl)phenyl]-N-[2-methyl-1-(3-methyl-2-pyridinyl)propyl]prop-2-enamide (PubChem CID 86954439) has the molecular formula C21H27N3O3S and a molecular weight of 401.53 g/mol. Its IUPAC name is (E)-3-[4-(dimethylsulfamoyl)phenyl]-N-[2-methyl-1-(3-methyl-2-pyridinyl)propyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(dimethylsulfamoyl)phenyl]-N-[2-methyl-1-(3-methyl-2-pyridinyl)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 86954439 |
| Molecular Formula | C21H27N3O3S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | (E)-3-[4-(dimethylsulfamoyl)phenyl]-N-[2-methyl-1-(3-methyl-2-pyridinyl)propyl]prop-2-enamide |
| SMILES | Cc1cccnc1C(NC(=O)/C=C/c1ccc(S(=O)(=O)N(C)C)cc1)C(C)C |
| InChI | InChI=1S/C21H27N3O3S/c1-15(2)20(21-16(3)7-6-14-22-21)23-19(25)13-10-17-8-11-18(12-9-17)28(26,27)24(4)5/h6-15,20H,1-5H3,(H,23,25)/b13-10+ |
| InChIKey | XKBVRVHITNFRBA-JLHYYAGUSA-N |
| XLogP | 3.17 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|