C23H20N2O3 — CID 86955688
[4-(pyridin-3-ylcarbamoyl)phenyl] 2-(2,3-dihydro-1H-inden-1-yl)acetate (PubChem CID 86955688) has the molecular formula C23H20N2O3 and a molecular weight of 372.42 g/mol. Its IUPAC name is [4-(pyridin-3-ylcarbamoyl)phenyl] 2-(2,3-dihydro-1H-inden-1-yl)acetate.
| Compound Name | [4-(pyridin-3-ylcarbamoyl)phenyl] 2-(2,3-dihydro-1H-inden-1-yl)acetate |
|---|---|
| PubChem CID | 86955688 |
| Molecular Formula | C23H20N2O3 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | [4-(pyridin-3-ylcarbamoyl)phenyl] 2-(2,3-dihydro-1H-inden-1-yl)acetate |
| SMILES | O=C(CC1CCc2ccccc21)Oc1ccc(C(=O)Nc2cccnc2)cc1 |
| InChI | InChI=1S/C23H20N2O3/c26-22(14-18-8-7-16-4-1-2-6-21(16)18)28-20-11-9-17(10-12-20)23(27)25-19-5-3-13-24-15-19/h1-6,9-13,15,18H,7-8,14H2,(H,25,27) |
| InChIKey | OOLYCBRRNQLQEX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|