C17H20BrN3O2S2 — CID 86958636
N-[4-(2-bromophenyl)sulfanylbutyl]-N'-(1,3-thiazol-2-yl)butanediamide (PubChem CID 86958636) has the molecular formula C17H20BrN3O2S2 and a molecular weight of 442.40 g/mol. Its IUPAC name is N-[4-(2-bromophenyl)sulfanylbutyl]-N'-(1,3-thiazol-2-yl)butanediamide.
| Compound Name | N-[4-(2-bromophenyl)sulfanylbutyl]-N'-(1,3-thiazol-2-yl)butanediamide |
|---|---|
| PubChem CID | 86958636 |
| Molecular Formula | C17H20BrN3O2S2 |
| Molecular Weight | 442.40 g/mol |
| Exact Mass | 441.02 |
| IUPAC Name | N-[4-(2-bromophenyl)sulfanylbutyl]-N'-(1,3-thiazol-2-yl)butanediamide |
| SMILES | O=C(CCC(=O)Nc1nccs1)NCCCCSc1ccccc1Br |
| InChI | InChI=1S/C17H20BrN3O2S2/c18-13-5-1-2-6-14(13)24-11-4-3-9-19-15(22)7-8-16(23)21-17-20-10-12-25-17/h1-2,5-6,10,12H,3-4,7-9,11H2,(H,19,22)(H,20,21,23) |
| InChIKey | VFFFUJCWJGZRIV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.40 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|