C17H25BrN2O2S — CID 86958637
N-[2-[4-(2-bromophenyl)sulfanylbutylamino]-2-oxoethyl]-2-methylbutanamide (PubChem CID 86958637) has the molecular formula C17H25BrN2O2S and a molecular weight of 401.37 g/mol. Its IUPAC name is N-[2-[4-(2-bromophenyl)sulfanylbutylamino]-2-oxoethyl]-2-methylbutanamide.
| Compound Name | N-[2-[4-(2-bromophenyl)sulfanylbutylamino]-2-oxoethyl]-2-methylbutanamide |
|---|---|
| PubChem CID | 86958637 |
| Molecular Formula | C17H25BrN2O2S |
| Molecular Weight | 401.37 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | N-[2-[4-(2-bromophenyl)sulfanylbutylamino]-2-oxoethyl]-2-methylbutanamide |
| SMILES | CCC(C)C(=O)NCC(=O)NCCCCSc1ccccc1Br |
| InChI | InChI=1S/C17H25BrN2O2S/c1-3-13(2)17(22)20-12-16(21)19-10-6-7-11-23-15-9-5-4-8-14(15)18/h4-5,8-9,13H,3,6-7,10-12H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | YSXLSZQLJOVDLQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|