About 2-[[3-(3-chloro-2-cyanophenoxy)benzoyl]amino]-N,N-dimethylbenzamide
2-[[3-(3-chloro-2-cyanophenoxy)benzoyl]amino]-N,N-dimethylbenzamide (PubChem CID 86962975) has the molecular formula C23H18ClN3O3
and a molecular weight of 419.87 g/mol. Its IUPAC name is 2-[[3-(3-chloro-2-cyanophenoxy)benzoyl]amino]-N,N-dimethylbenzamide.
Molecular Properties
| Compound Name | 2-[[3-(3-chloro-2-cyanophenoxy)benzoyl]amino]-N,N-dimethylbenzamide |
| PubChem CID | 86962975 |
| Molecular Formula | C23H18ClN3O3 |
| Molecular Weight | 419.87 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | 2-[[3-(3-chloro-2-cyanophenoxy)benzoyl]amino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccccc1NC(=O)c1cccc(Oc2cccc(Cl)c2C#N)c1 |
| InChI | InChI=1S/C23H18ClN3O3/c1-27(2)23(29)17-9-3-4-11-20(17)26-22(28)15-7-5-8-16(13-15)30-21-12-6-10-19(24)18(21)14-25/h3-13H,1-2H3,(H,26,28) |
| InChIKey | FDGPDLACGKDESA-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.87 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[3-(3-chloro-2-cyanophenoxy)benzoyl]amino]-N,N-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3-(3-chloro-2-cyanophenoxy)benzoyl]amino]-N,N-dimethylbenzamide?
The IUPAC name of 2-[[3-(3-chloro-2-cyanophenoxy)benzoyl]amino]-N,N-dimethylbenzamide (CID 86962975) is 2-[[3-(3-chloro-2-cyanophenoxy)benzoyl]amino]-N,N-dimethylbenzamide.
What is the SMILES notation for 2-[[3-(3-chloro-2-cyanophenoxy)benzoyl]amino]-N,N-dimethylbenzamide?
The canonical SMILES for 2-[[3-(3-chloro-2-cyanophenoxy)benzoyl]amino]-N,N-dimethylbenzamide is CN(C)C(=O)c1ccccc1NC(=O)c1cccc(Oc2cccc(Cl)c2C#N)c1.
What is the InChIKey of 2-[[3-(3-chloro-2-cyanophenoxy)benzoyl]amino]-N,N-dimethylbenzamide?
The InChIKey is FDGPDLACGKDESA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18ClN3O3/c1-27(2)23(29)17-9-3-4-11-20(17)26-22(28)15-7-5-8-16(13-15)30-21-12-6-10-19(24)18(21)14-25/h3-13H,1-2H3,(H,26,28).
What are the key properties of 2-[[3-(3-chloro-2-cyanophenoxy)benzoyl]amino]-N,N-dimethylbenzamide?
2-[[3-(3-chloro-2-cyanophenoxy)benzoyl]amino]-N,N-dimethylbenzamide has a molecular weight of 419.87 g/mol, XLogP of 4.96, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3-(3-chloro-2-cyanophenoxy)benzoyl]amino]-N,N-dimethylbenzamide is sourced from PubChem (CID 86962975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).