C23H18ClN3O3 — CID 86962975
2-[[3-(3-chloro-2-cyanophenoxy)benzoyl]amino]-N,N-dimethylbenzamide (PubChem CID 86962975) has the molecular formula C23H18ClN3O3 and a molecular weight of 419.87 g/mol. Its IUPAC name is 2-[[3-(3-chloro-2-cyanophenoxy)benzoyl]amino]-N,N-dimethylbenzamide.
| Compound Name | 2-[[3-(3-chloro-2-cyanophenoxy)benzoyl]amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 86962975 |
| Molecular Formula | C23H18ClN3O3 |
| Molecular Weight | 419.87 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | 2-[[3-(3-chloro-2-cyanophenoxy)benzoyl]amino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccccc1NC(=O)c1cccc(Oc2cccc(Cl)c2C#N)c1 |
| InChI | InChI=1S/C23H18ClN3O3/c1-27(2)23(29)17-9-3-4-11-20(17)26-22(28)15-7-5-8-16(13-15)30-21-12-6-10-19(24)18(21)14-25/h3-13H,1-2H3,(H,26,28) |
| InChIKey | FDGPDLACGKDESA-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.87 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |