C22H24ClN3O3 — CID 86963899
3-(3-chloro-2-cyanophenoxy)-N-(4-morpholin-4-ylbutan-2-yl)benzamide (PubChem CID 86963899) has the molecular formula C22H24ClN3O3 and a molecular weight of 413.91 g/mol. Its IUPAC name is 3-(3-chloro-2-cyanophenoxy)-N-(4-morpholin-4-ylbutan-2-yl)benzamide.
| Compound Name | 3-(3-chloro-2-cyanophenoxy)-N-(4-morpholin-4-ylbutan-2-yl)benzamide |
|---|---|
| PubChem CID | 86963899 |
| Molecular Formula | C22H24ClN3O3 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 3-(3-chloro-2-cyanophenoxy)-N-(4-morpholin-4-ylbutan-2-yl)benzamide |
| SMILES | CC(CCN1CCOCC1)NC(=O)c1cccc(Oc2cccc(Cl)c2C#N)c1 |
| InChI | InChI=1S/C22H24ClN3O3/c1-16(8-9-26-10-12-28-13-11-26)25-22(27)17-4-2-5-18(14-17)29-21-7-3-6-20(23)19(21)15-24/h2-7,14,16H,8-13H2,1H3,(H,25,27) |
| InChIKey | PGJPMQFKTLVMOH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |