C23H19ClN2O4 — CID 86962951
3-(3-chloro-2-cyanophenoxy)-N-(4,5-dimethoxy-2-methylphenyl)benzamide (PubChem CID 86962951) has the molecular formula C23H19ClN2O4 and a molecular weight of 422.87 g/mol. Its IUPAC name is 3-(3-chloro-2-cyanophenoxy)-N-(4,5-dimethoxy-2-methylphenyl)benzamide.
| Compound Name | 3-(3-chloro-2-cyanophenoxy)-N-(4,5-dimethoxy-2-methylphenyl)benzamide |
|---|---|
| PubChem CID | 86962951 |
| Molecular Formula | C23H19ClN2O4 |
| Molecular Weight | 422.87 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 3-(3-chloro-2-cyanophenoxy)-N-(4,5-dimethoxy-2-methylphenyl)benzamide |
| SMILES | COc1cc(C)c(NC(=O)c2cccc(Oc3cccc(Cl)c3C#N)c2)cc1OC |
| InChI | InChI=1S/C23H19ClN2O4/c1-14-10-21(28-2)22(29-3)12-19(14)26-23(27)15-6-4-7-16(11-15)30-20-9-5-8-18(24)17(20)13-25/h4-12H,1-3H3,(H,26,27) |
| InChIKey | SWQIHXVQCRZSEJ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.87 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |