C20H18N4O3S — CID 8696373
N-(3-methyl-1,3-benzothiazol-2-ylidene)-2-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetamide (PubChem CID 8696373) has the molecular formula C20H18N4O3S and a molecular weight of 394.46 g/mol. Its IUPAC name is N-(3-methyl-1,3-benzothiazol-2-ylidene)-2-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetamide.
| Compound Name | N-(3-methyl-1,3-benzothiazol-2-ylidene)-2-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 8696373 |
| Molecular Formula | C20H18N4O3S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | N-(3-methyl-1,3-benzothiazol-2-ylidene)-2-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetamide |
| SMILES | Cn1/c(=N/C(=O)CN2C(=O)N[C@@](C)(c3ccccc3)C2=O)sc2ccccc21 |
| InChI | InChI=1S/C20H18N4O3S/c1-20(13-8-4-3-5-9-13)17(26)24(18(27)22-20)12-16(25)21-19-23(2)14-10-6-7-11-15(14)28-19/h3-11H,12H2,1-2H3,(H,22,27)/b21-19-/t20-/m0/s1 |
| InChIKey | UZAJEGWWYTZNDF-LCPUNJGISA-N |
| XLogP | 2.13 |
| TPSA | 83.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|