C15H15ClF2N2O3S — CID 8696497
(3S,7aS)-N-[3-chloro-4-(difluoromethoxy)phenyl]-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 8696497) has the molecular formula C15H15ClF2N2O3S and a molecular weight of 376.81 g/mol. Its IUPAC name is (3S,7aS)-N-[3-chloro-4-(difluoromethoxy)phenyl]-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | (3S,7aS)-N-[3-chloro-4-(difluoromethoxy)phenyl]-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 8696497 |
| Molecular Formula | C15H15ClF2N2O3S |
| Molecular Weight | 376.81 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | (3S,7aS)-N-[3-chloro-4-(difluoromethoxy)phenyl]-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | C[C@]12CCC(=O)N1[C@@H](C(=O)Nc1ccc(OC(F)F)c(Cl)c1)CS2 |
| InChI | InChI=1S/C15H15ClF2N2O3S/c1-15-5-4-12(21)20(15)10(7-24-15)13(22)19-8-2-3-11(9(16)6-8)23-14(17)18/h2-3,6,10,14H,4-5,7H2,1H3,(H,19,22)/t10-,15+/m1/s1 |
| InChIKey | KHDXTCVKLMDVHQ-BMIGLBTASA-N |
| XLogP | 3.33 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.81 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |