C20H22FN3O5S — CID 86965282
N-[1-(2-fluoro-5-methylphenyl)piperidin-3-yl]-3-methylsulfonyl-5-nitrobenzamide (PubChem CID 86965282) has the molecular formula C20H22FN3O5S and a molecular weight of 435.48 g/mol. Its IUPAC name is N-[1-(2-fluoro-5-methylphenyl)piperidin-3-yl]-3-methylsulfonyl-5-nitrobenzamide.
| Compound Name | N-[1-(2-fluoro-5-methylphenyl)piperidin-3-yl]-3-methylsulfonyl-5-nitrobenzamide |
|---|---|
| PubChem CID | 86965282 |
| Molecular Formula | C20H22FN3O5S |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | N-[1-(2-fluoro-5-methylphenyl)piperidin-3-yl]-3-methylsulfonyl-5-nitrobenzamide |
| SMILES | Cc1ccc(F)c(N2CCCC(NC(=O)c3cc([N+](=O)[O-])cc(S(C)(=O)=O)c3)C2)c1 |
| InChI | InChI=1S/C20H22FN3O5S/c1-13-5-6-18(21)19(8-13)23-7-3-4-15(12-23)22-20(25)14-9-16(24(26)27)11-17(10-14)30(2,28)29/h5-6,8-11,15H,3-4,7,12H2,1-2H3,(H,22,25) |
| InChIKey | MSVAJVNVINKQNM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|