C18H22FN3O3S2 — CID 86966202
N-[1-(2-fluoro-5-methylphenyl)piperidin-3-yl]-2-(thiophen-2-ylsulfonylamino)acetamide (PubChem CID 86966202) has the molecular formula C18H22FN3O3S2 and a molecular weight of 411.52 g/mol. Its IUPAC name is N-[1-(2-fluoro-5-methylphenyl)piperidin-3-yl]-2-(thiophen-2-ylsulfonylamino)acetamide.
| Compound Name | N-[1-(2-fluoro-5-methylphenyl)piperidin-3-yl]-2-(thiophen-2-ylsulfonylamino)acetamide |
|---|---|
| PubChem CID | 86966202 |
| Molecular Formula | C18H22FN3O3S2 |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | N-[1-(2-fluoro-5-methylphenyl)piperidin-3-yl]-2-(thiophen-2-ylsulfonylamino)acetamide |
| SMILES | Cc1ccc(F)c(N2CCCC(NC(=O)CNS(=O)(=O)c3cccs3)C2)c1 |
| InChI | InChI=1S/C18H22FN3O3S2/c1-13-6-7-15(19)16(10-13)22-8-2-4-14(12-22)21-17(23)11-20-27(24,25)18-5-3-9-26-18/h3,5-7,9-10,14,20H,2,4,8,11-12H2,1H3,(H,21,23) |
| InChIKey | ISVVWKQPTQHJLZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |