C22H24F2N2O4 — CID 86970755
methyl 4-[4-[2-[2-(difluoromethoxy)phenyl]acetyl]-3-methylpiperazin-1-yl]benzoate (PubChem CID 86970755) has the molecular formula C22H24F2N2O4 and a molecular weight of 418.44 g/mol. Its IUPAC name is methyl 4-[4-[2-[2-(difluoromethoxy)phenyl]acetyl]-3-methylpiperazin-1-yl]benzoate.
| Compound Name | methyl 4-[4-[2-[2-(difluoromethoxy)phenyl]acetyl]-3-methylpiperazin-1-yl]benzoate |
|---|---|
| PubChem CID | 86970755 |
| Molecular Formula | C22H24F2N2O4 |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | methyl 4-[4-[2-[2-(difluoromethoxy)phenyl]acetyl]-3-methylpiperazin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2CCN(C(=O)Cc3ccccc3OC(F)F)C(C)C2)cc1 |
| InChI | InChI=1S/C22H24F2N2O4/c1-15-14-25(18-9-7-16(8-10-18)21(28)29-2)11-12-26(15)20(27)13-17-5-3-4-6-19(17)30-22(23)24/h3-10,15,22H,11-14H2,1-2H3 |
| InChIKey | UIOUQEZDMUXATR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |