C23H27FN2O4S — CID 86971225
(4-fluoro-3-pyrrolidin-1-ylsulfonylphenyl)-[3-(phenoxymethyl)piperidin-1-yl]methanone (PubChem CID 86971225) has the molecular formula C23H27FN2O4S and a molecular weight of 446.54 g/mol. Its IUPAC name is (4-fluoro-3-pyrrolidin-1-ylsulfonylphenyl)-[3-(phenoxymethyl)piperidin-1-yl]methanone.
| Compound Name | (4-fluoro-3-pyrrolidin-1-ylsulfonylphenyl)-[3-(phenoxymethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 86971225 |
| Molecular Formula | C23H27FN2O4S |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | (4-fluoro-3-pyrrolidin-1-ylsulfonylphenyl)-[3-(phenoxymethyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(F)c(S(=O)(=O)N2CCCC2)c1)N1CCCC(COc2ccccc2)C1 |
| InChI | InChI=1S/C23H27FN2O4S/c24-21-11-10-19(15-22(21)31(28,29)26-13-4-5-14-26)23(27)25-12-6-7-18(16-25)17-30-20-8-2-1-3-9-20/h1-3,8-11,15,18H,4-7,12-14,16-17H2 |
| InChIKey | KIJQPXIDBRXEIL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |