C21H20N2O5S — CID 86973700
ethyl 2-[ethyl-[5-(furan-2-carbonylamino)thiophene-2-carbonyl]amino]benzoate (PubChem CID 86973700) has the molecular formula C21H20N2O5S and a molecular weight of 412.47 g/mol. Its IUPAC name is ethyl 2-[ethyl-[5-(furan-2-carbonylamino)thiophene-2-carbonyl]amino]benzoate.
| Compound Name | ethyl 2-[ethyl-[5-(furan-2-carbonylamino)thiophene-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 86973700 |
| Molecular Formula | C21H20N2O5S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | ethyl 2-[ethyl-[5-(furan-2-carbonylamino)thiophene-2-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1N(CC)C(=O)c1ccc(NC(=O)c2ccco2)s1 |
| InChI | InChI=1S/C21H20N2O5S/c1-3-23(15-9-6-5-8-14(15)21(26)27-4-2)20(25)17-11-12-18(29-17)22-19(24)16-10-7-13-28-16/h5-13H,3-4H2,1-2H3,(H,22,24) |
| InChIKey | WAZPVTGGOLVRLR-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |